Naphthalene-13C10
Catalog No: FT-0672612
CAS No: 219526-41-7
- Chemical Name: Naphthalene-13C10
- Molecular Formula: C10H8
- Molecular Weight: 138.097
- InChI Key: UFWIBTONFRDIAS-IIYFYTTLSA-N
- InChI: InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 138.09700 |
| Density: | N/A |
| CAS: | 219526-41-7 |
| Bolling_Point: | 218ºC(lit.) |
| Product_Name: | naphthalene |
| Melting_Point: | 80-82ºC(lit.) |
| Flash_Point: | 80 °C |
| MF: | C10H8 |
| LogP: | 2.83980 |
|---|---|
| Melting_Point: | 80-82ºC(lit.) |
| FW: | 138.09700 |
| MF: | C10H8 |
| Bolling_Point: | 218ºC(lit.) |
| Exact_Mass: | 138.09600 |
| Hazard_Codes: | Xn: Harmful;N: Dangerous for the environment; |
|---|---|
| Flash_Point_(C): | 80 °C |
| Risk_Statements(EU): | 22-40-50/53 |
| Safety_Statements: | 36/37-46-60-61 |
| Symbol: | Warning |
| Flash_Point_(F): | 176 °F |
| RIDADR: | UN 1334 4.1/PG 3 |
| Warning_Statement: | P210-P280-P301 + P312 + P330-P370 + P378 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)